C12H17Cl2N3O2 — CID 3738621
3-(2,6-dichloro-4-pyridinyl)-1-(2-methoxyethyl)-1-propylurea (PubChem CID 3738621) has the molecular formula C12H17Cl2N3O2 and a molecular weight of 306.19 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-pyridinyl)-1-(2-methoxyethyl)-1-propylurea.
| Compound Name | 3-(2,6-dichloro-4-pyridinyl)-1-(2-methoxyethyl)-1-propylurea |
|---|---|
| PubChem CID | 3738621 |
| Molecular Formula | C12H17Cl2N3O2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-(2,6-dichloro-4-pyridinyl)-1-(2-methoxyethyl)-1-propylurea |
| SMILES | CCCN(CCOC)C(=O)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2N3O2/c1-3-4-17(5-6-19-2)12(18)15-9-7-10(13)16-11(14)8-9/h7-8H,3-6H2,1-2H3,(H,15,16,18) |
| InChIKey | NTADDHVBSQXDJU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|