C13H19Cl2NO4 — CID 104561220
3,6-dichloro-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]pyridine (PubChem CID 104561220) has the molecular formula C13H19Cl2NO4 and a molecular weight of 324.20 g/mol. Its IUPAC name is 3,6-dichloro-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]pyridine.
| Compound Name | 3,6-dichloro-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]pyridine |
|---|---|
| PubChem CID | 104561220 |
| Molecular Formula | C13H19Cl2NO4 |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3,6-dichloro-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]pyridine |
| SMILES | COCCOCCOCCOCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H19Cl2NO4/c1-17-4-5-18-6-7-19-8-9-20-10-12-11(14)2-3-13(15)16-12/h2-3H,4-10H2,1H3 |
| InChIKey | IHOPOBIBOYLQNZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|