C7H8Cl2N2O — CID 131041653
1-(3,6-dichloro-2-pyridinyl)-N-methoxymethanamine (PubChem CID 131041653) has the molecular formula C7H8Cl2N2O and a molecular weight of 207.06 g/mol. Its IUPAC name is 1-(3,6-dichloro-2-pyridinyl)-N-methoxymethanamine.
| Compound Name | 1-(3,6-dichloro-2-pyridinyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 131041653 |
| Molecular Formula | C7H8Cl2N2O |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 1-(3,6-dichloro-2-pyridinyl)-N-methoxymethanamine |
| SMILES | CONCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C7H8Cl2N2O/c1-12-10-4-6-5(8)2-3-7(9)11-6/h2-3,10H,4H2,1H3 |
| InChIKey | XTUSUXIGRGOCAP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|