C14H13Cl2NO2 — CID 55127453
3,6-dichloro-2-[(2-ethoxyphenoxy)methyl]pyridine (PubChem CID 55127453) has the molecular formula C14H13Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is 3,6-dichloro-2-[(2-ethoxyphenoxy)methyl]pyridine.
| Compound Name | 3,6-dichloro-2-[(2-ethoxyphenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 55127453 |
| Molecular Formula | C14H13Cl2NO2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 3,6-dichloro-2-[(2-ethoxyphenoxy)methyl]pyridine |
| SMILES | CCOc1ccccc1OCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2NO2/c1-2-18-12-5-3-4-6-13(12)19-9-11-10(15)7-8-14(16)17-11/h3-8H,2,9H2,1H3 |
| InChIKey | PDIHIMZIHJGNRP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|