C12H14Cl2N2O4 — CID 62955033
methyl 2-[(3,6-dichloro-2-pyridinyl)methyl-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 62955033) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is methyl 2-[(3,6-dichloro-2-pyridinyl)methyl-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[(3,6-dichloro-2-pyridinyl)methyl-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 62955033 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | methyl 2-[(3,6-dichloro-2-pyridinyl)methyl-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)Cc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-19-11(17)6-16(7-12(18)20-2)5-9-8(13)3-4-10(14)15-9/h3-4H,5-7H2,1-2H3 |
| InChIKey | PDESBEGHIBZTEX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|