C12H17Cl2NO3 — CID 106994670
2,6-dichloro-3-[2-(3-methoxypropoxy)ethoxymethyl]pyridine (PubChem CID 106994670) has the molecular formula C12H17Cl2NO3 and a molecular weight of 294.18 g/mol. Its IUPAC name is 2,6-dichloro-3-[2-(3-methoxypropoxy)ethoxymethyl]pyridine.
| Compound Name | 2,6-dichloro-3-[2-(3-methoxypropoxy)ethoxymethyl]pyridine |
|---|---|
| PubChem CID | 106994670 |
| Molecular Formula | C12H17Cl2NO3 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2,6-dichloro-3-[2-(3-methoxypropoxy)ethoxymethyl]pyridine |
| SMILES | COCCCOCCOCc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C12H17Cl2NO3/c1-16-5-2-6-17-7-8-18-9-10-3-4-11(13)15-12(10)14/h3-4H,2,5-9H2,1H3 |
| InChIKey | POBOWYNUZILBCO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|