C14H19ClO5 — CID 103175941
3-chloro-4-[2-(3-methoxypropoxy)ethoxymethyl]benzoic acid (PubChem CID 103175941) has the molecular formula C14H19ClO5 and a molecular weight of 302.75 g/mol. Its IUPAC name is 3-chloro-4-[2-(3-methoxypropoxy)ethoxymethyl]benzoic acid.
| Compound Name | 3-chloro-4-[2-(3-methoxypropoxy)ethoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 103175941 |
| Molecular Formula | C14H19ClO5 |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-chloro-4-[2-(3-methoxypropoxy)ethoxymethyl]benzoic acid |
| SMILES | COCCCOCCOCc1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C14H19ClO5/c1-18-5-2-6-19-7-8-20-10-12-4-3-11(14(16)17)9-13(12)15/h3-4,9H,2,5-8,10H2,1H3,(H,16,17) |
| InChIKey | WTNGTCSACKHOEX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|