C11H15ClN2O2 — CID 102668854
4-(3-aminopropoxymethyl)-3-chlorobenzamide (PubChem CID 102668854) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 4-(3-aminopropoxymethyl)-3-chlorobenzamide.
| Compound Name | 4-(3-aminopropoxymethyl)-3-chlorobenzamide |
|---|---|
| PubChem CID | 102668854 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-(3-aminopropoxymethyl)-3-chlorobenzamide |
| SMILES | NCCCOCc1ccc(C(N)=O)cc1Cl |
| InChI | InChI=1S/C11H15ClN2O2/c12-10-6-8(11(14)15)2-3-9(10)7-16-5-1-4-13/h2-3,6H,1,4-5,7,13H2,(H2,14,15) |
| InChIKey | WFJRKOYQFVFKNV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|