C14H20ClNO2S — CID 102666550
4-(2-butoxyethoxymethyl)-3-chlorobenzenecarbothioamide (PubChem CID 102666550) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is 4-(2-butoxyethoxymethyl)-3-chlorobenzenecarbothioamide.
| Compound Name | 4-(2-butoxyethoxymethyl)-3-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 102666550 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-(2-butoxyethoxymethyl)-3-chlorobenzenecarbothioamide |
| SMILES | CCCCOCCOCc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C14H20ClNO2S/c1-2-3-6-17-7-8-18-10-12-5-4-11(14(16)19)9-13(12)15/h4-5,9H,2-3,6-8,10H2,1H3,(H2,16,19) |
| InChIKey | ILQQIOMCHFIVKP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|