C12H17NO2S — CID 114482192
4-(2-methoxyethoxymethyl)-3-methylbenzenecarbothioamide (PubChem CID 114482192) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-(2-methoxyethoxymethyl)-3-methylbenzenecarbothioamide.
| Compound Name | 4-(2-methoxyethoxymethyl)-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 114482192 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 4-(2-methoxyethoxymethyl)-3-methylbenzenecarbothioamide |
| SMILES | COCCOCc1ccc(C(N)=S)cc1C |
| InChI | InChI=1S/C12H17NO2S/c1-9-7-10(12(13)16)3-4-11(9)8-15-6-5-14-2/h3-4,7H,5-6,8H2,1-2H3,(H2,13,16) |
| InChIKey | KJENKLHIRRDODI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|