C16H26N2OS — CID 114481829
4-[[2-methoxyethyl(2-methylpropyl)amino]methyl]-3-methylbenzenecarbothioamide (PubChem CID 114481829) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is 4-[[2-methoxyethyl(2-methylpropyl)amino]methyl]-3-methylbenzenecarbothioamide.
| Compound Name | 4-[[2-methoxyethyl(2-methylpropyl)amino]methyl]-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 114481829 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 4-[[2-methoxyethyl(2-methylpropyl)amino]methyl]-3-methylbenzenecarbothioamide |
| SMILES | COCCN(Cc1ccc(C(N)=S)cc1C)CC(C)C |
| InChI | InChI=1S/C16H26N2OS/c1-12(2)10-18(7-8-19-4)11-15-6-5-14(16(17)20)9-13(15)3/h5-6,9,12H,7-8,10-11H2,1-4H3,(H2,17,20) |
| InChIKey | VVFHQRJPJBJHQV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|