C11H14FNOS — CID 43248082
3-fluoro-4-(propoxymethyl)benzenecarbothioamide (PubChem CID 43248082) has the molecular formula C11H14FNOS and a molecular weight of 227.30 g/mol. Its IUPAC name is 3-fluoro-4-(propoxymethyl)benzenecarbothioamide.
| Compound Name | 3-fluoro-4-(propoxymethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 43248082 |
| Molecular Formula | C11H14FNOS |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-fluoro-4-(propoxymethyl)benzenecarbothioamide |
| SMILES | CCCOCc1ccc(C(N)=S)cc1F |
| InChI | InChI=1S/C11H14FNOS/c1-2-5-14-7-9-4-3-8(11(13)15)6-10(9)12/h3-4,6H,2,5,7H2,1H3,(H2,13,15) |
| InChIKey | QUUHOYSOWWNBBQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|