C14H18FNOS — CID 66321774
4-(cyclopentylmethoxymethyl)-3-fluorobenzenecarbothioamide (PubChem CID 66321774) has the molecular formula C14H18FNOS and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-(cyclopentylmethoxymethyl)-3-fluorobenzenecarbothioamide.
| Compound Name | 4-(cyclopentylmethoxymethyl)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 66321774 |
| Molecular Formula | C14H18FNOS |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-(cyclopentylmethoxymethyl)-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(COCC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C14H18FNOS/c15-13-7-11(14(16)18)5-6-12(13)9-17-8-10-3-1-2-4-10/h5-7,10H,1-4,8-9H2,(H2,16,18) |
| InChIKey | CERJRZIQAUQJAG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|