C11H15N3O4 — CID 164537142
tert-butyl N-(6-formyl-5-methoxypyridazin-3-yl)carbamate (PubChem CID 164537142) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is tert-butyl N-(6-formyl-5-methoxypyridazin-3-yl)carbamate.
| Compound Name | tert-butyl N-(6-formyl-5-methoxypyridazin-3-yl)carbamate |
|---|---|
| PubChem CID | 164537142 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | tert-butyl N-(6-formyl-5-methoxypyridazin-3-yl)carbamate |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)nnc1C=O |
| InChI | InChI=1S/C11H15N3O4/c1-11(2,3)18-10(16)12-9-5-8(17-4)7(6-15)13-14-9/h5-6H,1-4H3,(H,12,14,16) |
| InChIKey | TVEKZWRNZFLGEO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|