C14H24N4O2 — CID 113044818
tert-butyl N-[6-[butyl(methyl)amino]pyridazin-3-yl]carbamate (PubChem CID 113044818) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl N-[6-[butyl(methyl)amino]pyridazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[6-[butyl(methyl)amino]pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 113044818 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | tert-butyl N-[6-[butyl(methyl)amino]pyridazin-3-yl]carbamate |
| SMILES | CCCCN(C)c1ccc(NC(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C14H24N4O2/c1-6-7-10-18(5)12-9-8-11(16-17-12)15-13(19)20-14(2,3)4/h8-9H,6-7,10H2,1-5H3,(H,15,16,19) |
| InChIKey | HHKKUMSMELADBB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |