C22H32BrN7O3 — CID 178071553
tert-butyl N-[5-[[6-bromo-3-[[6-(dimethylamino)pyridazin-3-yl]carbamoyl]-2-pyridinyl]amino]pentyl]carbamate (PubChem CID 178071553) has the molecular formula C22H32BrN7O3 and a molecular weight of 522.45 g/mol. Its IUPAC name is tert-butyl N-[5-[[6-bromo-3-[[6-(dimethylamino)pyridazin-3-yl]carbamoyl]-2-pyridinyl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[6-bromo-3-[[6-(dimethylamino)pyridazin-3-yl]carbamoyl]-2-pyridinyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 178071553 |
| Molecular Formula | C22H32BrN7O3 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | tert-butyl N-[5-[[6-bromo-3-[[6-(dimethylamino)pyridazin-3-yl]carbamoyl]-2-pyridinyl]amino]pentyl]carbamate |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc(Br)nc2NCCCCCNC(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C22H32BrN7O3/c1-22(2,3)33-21(32)25-14-8-6-7-13-24-19-15(9-10-16(23)26-19)20(31)27-17-11-12-18(29-28-17)30(4)5/h9-12H,6-8,13-14H2,1-5H3,(H,24,26)(H,25,32)(H,27,28,31) |
| InChIKey | WLMYAOGGPSFUFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|