C21H31N7O4 — CID 178071195
tert-butyl N-[5-[[6-(methylamino)-3-[(6-oxo-1H-pyridazin-3-yl)carbamoyl]-2-pyridinyl]amino]pentyl]carbamate (PubChem CID 178071195) has the molecular formula C21H31N7O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is tert-butyl N-[5-[[6-(methylamino)-3-[(6-oxo-1H-pyridazin-3-yl)carbamoyl]-2-pyridinyl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[6-(methylamino)-3-[(6-oxo-1H-pyridazin-3-yl)carbamoyl]-2-pyridinyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 178071195 |
| Molecular Formula | C21H31N7O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | tert-butyl N-[5-[[6-(methylamino)-3-[(6-oxo-1H-pyridazin-3-yl)carbamoyl]-2-pyridinyl]amino]pentyl]carbamate |
| SMILES | CNc1ccc(C(=O)Nc2ccc(=O)[nH]n2)c(NCCCCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C21H31N7O4/c1-21(2,3)32-20(31)24-13-7-5-6-12-23-18-14(8-9-15(22-4)25-18)19(30)26-16-10-11-17(29)28-27-16/h8-11H,5-7,12-13H2,1-4H3,(H,24,31)(H,28,29)(H2,22,23,25)(H,26,27,30) |
| InChIKey | ZAIRYJKJIUZXIU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 150.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|