C24H36N4O3S — CID 176835947
tert-butyl N-[7-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoyl]anilino]heptyl]carbamate (PubChem CID 176835947) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is tert-butyl N-[7-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoyl]anilino]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoyl]anilino]heptyl]carbamate |
|---|---|
| PubChem CID | 176835947 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | tert-butyl N-[7-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoyl]anilino]heptyl]carbamate |
| SMILES | Cc1nc(NC(=O)c2ccccc2NCCCCCCCNC(=O)OC(C)(C)C)sc1C |
| InChI | InChI=1S/C24H36N4O3S/c1-17-18(2)32-22(27-17)28-21(29)19-13-9-10-14-20(19)25-15-11-7-6-8-12-16-26-23(30)31-24(3,4)5/h9-10,13-14,25H,6-8,11-12,15-16H2,1-5H3,(H,26,30)(H,27,28,29) |
| InChIKey | ZUXIHLCGPSUEDB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|