C21H31N5O4S — CID 166873098
tert-butyl N-[5-[2-[(5-amino-4-methyl-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]anilino]-5-oxopentyl]carbamate (PubChem CID 166873098) has the molecular formula C21H31N5O4S and a molecular weight of 449.58 g/mol. Its IUPAC name is tert-butyl N-[5-[2-[(5-amino-4-methyl-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]anilino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-[(5-amino-4-methyl-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]anilino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 166873098 |
| Molecular Formula | C21H31N5O4S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | tert-butyl N-[5-[2-[(5-amino-4-methyl-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]anilino]-5-oxopentyl]carbamate |
| SMILES | CC1N=C(NC(=O)c2ccccc2NC(=O)CCCCNC(=O)OC(C)(C)C)SC1N |
| InChI | InChI=1S/C21H31N5O4S/c1-13-17(22)31-19(24-13)26-18(28)14-9-5-6-10-15(14)25-16(27)11-7-8-12-23-20(29)30-21(2,3)4/h5-6,9-10,13,17H,7-8,11-12,22H2,1-4H3,(H,23,29)(H,25,27)(H,24,26,28) |
| InChIKey | NVDARQXTOCDHKH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|