C22H30N2O8 — CID 46222746
2-methylpropoxycarbonyl 2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]phenyl]-2-oxoacetate (PubChem CID 46222746) has the molecular formula C22H30N2O8 and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-methylpropoxycarbonyl 2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]phenyl]-2-oxoacetate.
| Compound Name | 2-methylpropoxycarbonyl 2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 46222746 |
| Molecular Formula | C22H30N2O8 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-methylpropoxycarbonyl 2-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]phenyl]-2-oxoacetate |
| SMILES | CC(C)COC(=O)OC(=O)C(=O)c1ccccc1NC(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O8/c1-14(2)13-30-21(29)31-19(27)18(26)15-9-6-7-10-16(15)24-17(25)11-8-12-23-20(28)32-22(3,4)5/h6-7,9-10,14H,8,11-13H2,1-5H3,(H,23,28)(H,24,25) |
| InChIKey | FTXHMJCCRGVMIB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|