C13H12N4OS — CID 110700966
N-(4,5-dimethyl-1,3-thiazol-2-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 110700966) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 110700966 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1nc(NC(=O)c2cccc3[nH]cnc23)sc1C |
| InChI | InChI=1S/C13H12N4OS/c1-7-8(2)19-13(16-7)17-12(18)9-4-3-5-10-11(9)15-6-14-10/h3-6H,1-2H3,(H,14,15)(H,16,17,18) |
| InChIKey | GCCBUXOROKEOGW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |