C15H26N4O3 — CID 136900907
tert-butyl N-[3-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]propyl]carbamate (PubChem CID 136900907) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 136900907 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | tert-butyl N-[3-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]propyl]carbamate |
| SMILES | CC(C)c1nc(NCCCNC(=O)OC(C)(C)C)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H26N4O3/c1-10(2)13-18-11(9-12(20)19-13)16-7-6-8-17-14(21)22-15(3,4)5/h9-10H,6-8H2,1-5H3,(H,17,21)(H2,16,18,19,20) |
| InChIKey | IFKIFYOXUUCRTR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|