C17H30N4O2 — CID 126849670
tert-butyl N-[3-[(6-pentan-3-ylpyrimidin-4-yl)amino]propyl]carbamate (PubChem CID 126849670) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-pentan-3-ylpyrimidin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(6-pentan-3-ylpyrimidin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 126849670 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | tert-butyl N-[3-[(6-pentan-3-ylpyrimidin-4-yl)amino]propyl]carbamate |
| SMILES | CCC(CC)c1cc(NCCCNC(=O)OC(C)(C)C)ncn1 |
| InChI | InChI=1S/C17H30N4O2/c1-6-13(7-2)14-11-15(21-12-20-14)18-9-8-10-19-16(22)23-17(3,4)5/h11-13H,6-10H2,1-5H3,(H,19,22)(H,18,20,21) |
| InChIKey | HEAUGPNNRKTGFP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|