C14H22N4O3 — CID 136977515
tert-butyl N-[2-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]carbamate (PubChem CID 136977515) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 136977515 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | tert-butyl N-[2-[(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C14H22N4O3/c1-14(2,3)21-13(20)16-7-6-15-10-8-11(19)18-12(17-10)9-4-5-9/h8-9H,4-7H2,1-3H3,(H,16,20)(H2,15,17,18,19) |
| InChIKey | JYUNPTDPTJRKKU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|