C18H25N5O3S — CID 113044795
N-[6-[butyl(methyl)amino]pyridazin-3-yl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 113044795) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is N-[6-[butyl(methyl)amino]pyridazin-3-yl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[6-[butyl(methyl)amino]pyridazin-3-yl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 113044795 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[6-[butyl(methyl)amino]pyridazin-3-yl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CCCCN(C)c1ccc(NC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)nn1 |
| InChI | InChI=1S/C18H25N5O3S/c1-5-6-13-23(4)17-12-11-16(20-21-17)19-18(24)14-7-9-15(10-8-14)27(25,26)22(2)3/h7-12H,5-6,13H2,1-4H3,(H,19,20,24) |
| InChIKey | BNWZLMNLOLVKID-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |