C14H15ClN4O2 — CID 177188563
tert-butyl N-[4-(6-chloropyridazin-3-yl)-3-pyridinyl]carbamate (PubChem CID 177188563) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is tert-butyl N-[4-(6-chloropyridazin-3-yl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-(6-chloropyridazin-3-yl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 177188563 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | tert-butyl N-[4-(6-chloropyridazin-3-yl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnccc1-c1ccc(Cl)nn1 |
| InChI | InChI=1S/C14H15ClN4O2/c1-14(2,3)21-13(20)17-11-8-16-7-6-9(11)10-4-5-12(15)19-18-10/h4-8H,1-3H3,(H,17,20) |
| InChIKey | JIKXPYVVYAOHIM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |