C12H17FN2O2 — CID 86706800
tert-butyl N-[3-(2-fluoroethyl)-4-pyridinyl]carbamate (PubChem CID 86706800) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is tert-butyl N-[3-(2-fluoroethyl)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-fluoroethyl)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 86706800 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | tert-butyl N-[3-(2-fluoroethyl)-4-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccncc1CCF |
| InChI | InChI=1S/C12H17FN2O2/c1-12(2,3)17-11(16)15-10-5-7-14-8-9(10)4-6-13/h5,7-8H,4,6H2,1-3H3,(H,14,15,16) |
| InChIKey | ADEYHCLFCIMZPG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |