C12H13ClFN3O3 — CID 126623338
methyl 2-chloro-6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-4-carboxylate (PubChem CID 126623338) has the molecular formula C12H13ClFN3O3 and a molecular weight of 301.71 g/mol. Its IUPAC name is methyl 2-chloro-6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-4-carboxylate.
| Compound Name | methyl 2-chloro-6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 126623338 |
| Molecular Formula | C12H13ClFN3O3 |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | methyl 2-chloro-6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)nc(NC(=O)[C@@H]2C[C@@H](F)CN2)c1 |
| InChI | InChI=1S/C12H13ClFN3O3/c1-20-12(19)6-2-9(13)16-10(3-6)17-11(18)8-4-7(14)5-15-8/h2-3,7-8,15H,4-5H2,1H3,(H,16,17,18)/t7-,8+/m1/s1 |
| InChIKey | GQVNMOIBDROKSQ-SFYZADRCSA-N |
| XLogP | 1.16 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|