C11H14FN3O — CID 126623254
(2S,4R)-4-fluoro-N-(2-methyl-4-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 126623254) has the molecular formula C11H14FN3O and a molecular weight of 223.25 g/mol. Its IUPAC name is (2S,4R)-4-fluoro-N-(2-methyl-4-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-fluoro-N-(2-methyl-4-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126623254 |
| Molecular Formula | C11H14FN3O |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2S,4R)-4-fluoro-N-(2-methyl-4-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@@H]2C[C@@H](F)CN2)ccn1 |
| InChI | InChI=1S/C11H14FN3O/c1-7-4-9(2-3-13-7)15-11(16)10-5-8(12)6-14-10/h2-4,8,10,14H,5-6H2,1H3,(H,13,15,16)/t8-,10+/m1/s1 |
| InChIKey | YELRVGHCMSRDAH-SCZZXKLOSA-N |
| XLogP | 1.03 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |