C9H12N4 — CID 115969557
6-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine (PubChem CID 115969557) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine.
| Compound Name | 6-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 115969557 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-amine |
| SMILES | Nc1cncc(N2CC=CCC2)n1 |
| InChI | InChI=1S/C9H12N4/c10-8-6-11-7-9(12-8)13-4-2-1-3-5-13/h1-2,6-7H,3-5H2,(H2,10,12) |
| InChIKey | MGPCOCIUJHYPBK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|