C27H27N5O2 — CID 11190242
4-ethenyl-N-[2-[(4-ethenylbenzoyl)amino]-6-piperidin-1-ylpyrimidin-4-yl]benzamide (PubChem CID 11190242) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 4-ethenyl-N-[2-[(4-ethenylbenzoyl)amino]-6-piperidin-1-ylpyrimidin-4-yl]benzamide.
| Compound Name | 4-ethenyl-N-[2-[(4-ethenylbenzoyl)amino]-6-piperidin-1-ylpyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 11190242 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 4-ethenyl-N-[2-[(4-ethenylbenzoyl)amino]-6-piperidin-1-ylpyrimidin-4-yl]benzamide |
| SMILES | C=Cc1ccc(C(=O)Nc2cc(N3CCCCC3)nc(NC(=O)c3ccc(C=C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-3-19-8-12-21(13-9-19)25(33)28-23-18-24(32-16-6-5-7-17-32)30-27(29-23)31-26(34)22-14-10-20(4-2)11-15-22/h3-4,8-15,18H,1-2,5-7,16-17H2,(H2,28,29,30,31,33,34) |
| InChIKey | CZEHPYKERRCHGS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |