C15H27N5 — CID 70171641
6-piperidin-1-yl-2-N,4-N-dipropylpyrimidine-2,4-diamine (PubChem CID 70171641) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 6-piperidin-1-yl-2-N,4-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 6-piperidin-1-yl-2-N,4-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 70171641 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 6-piperidin-1-yl-2-N,4-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCNc1cc(N2CCCCC2)nc(NCCC)n1 |
| InChI | InChI=1S/C15H27N5/c1-3-8-16-13-12-14(20-10-6-5-7-11-20)19-15(18-13)17-9-4-2/h12H,3-11H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | LASWHQIEGNYXED-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |