C21H25N5O4 — CID 168567390
dimethyl (E)-2-[4-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]anilino]but-2-enedioate (PubChem CID 168567390) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567390 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | dimethyl (E)-2-[4-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(Nc2cc(N3CCCC3)nc(C)n2)cc1)C(=O)OC |
| InChI | InChI=1S/C21H25N5O4/c1-14-22-18(13-19(23-14)26-10-4-5-11-26)25-16-8-6-15(7-9-16)24-17(21(28)30-3)12-20(27)29-2/h6-9,12-13,24H,4-5,10-11H2,1-3H3,(H,22,23,25)/b17-12+ |
| InChIKey | QTRSXLGCWIJGTQ-SFQUDFHCSA-N |
| XLogP | 2.77 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|