C10H11ClN2O2 — CID 69135930
5-chloro-1-N,3-dimethylbenzene-1,2-dicarboxamide (PubChem CID 69135930) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 5-chloro-1-N,3-dimethylbenzene-1,2-dicarboxamide.
| Compound Name | 5-chloro-1-N,3-dimethylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 69135930 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5-chloro-1-N,3-dimethylbenzene-1,2-dicarboxamide |
| SMILES | CNC(=O)c1cc(Cl)cc(C)c1C(N)=O |
| InChI | InChI=1S/C10H11ClN2O2/c1-5-3-6(11)4-7(10(15)13-2)8(5)9(12)14/h3-4H,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | FFALJFVXGBFGAY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |