C19H16Cl2F3N5O2 — CID 173469407
2-[[4-amino-2-[(3-chloro-2-pyridinyl)imino]-5,5,5-trifluoropent-3-enoyl]amino]-5-chloro-N,3-dimethylbenzamide (PubChem CID 173469407) has the molecular formula C19H16Cl2F3N5O2 and a molecular weight of 474.27 g/mol. Its IUPAC name is 2-[[4-amino-2-[(3-chloro-2-pyridinyl)imino]-5,5,5-trifluoropent-3-enoyl]amino]-5-chloro-N,3-dimethylbenzamide.
| Compound Name | 2-[[4-amino-2-[(3-chloro-2-pyridinyl)imino]-5,5,5-trifluoropent-3-enoyl]amino]-5-chloro-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 173469407 |
| Molecular Formula | C19H16Cl2F3N5O2 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 2-[[4-amino-2-[(3-chloro-2-pyridinyl)imino]-5,5,5-trifluoropent-3-enoyl]amino]-5-chloro-N,3-dimethylbenzamide |
| SMILES | CNC(=O)c1cc(Cl)cc(C)c1NC(=O)C(C=C(N)C(F)(F)F)=Nc1ncccc1Cl |
| InChI | InChI=1S/C19H16Cl2F3N5O2/c1-9-6-10(20)7-11(17(30)26-2)15(9)29-18(31)13(8-14(25)19(22,23)24)28-16-12(21)4-3-5-27-16/h3-8H,25H2,1-2H3,(H,26,30)(H,29,31) |
| InChIKey | MRYQBKBRUKBXAT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|