C20H16Cl2F3N9O2 — CID 90808593
N-(2-carbamoyl-4-chloro-6-methylphenyl)-1-(3-chloro-2-pyridinyl)-3-[[(2,2,2-trifluoroethanehydrazonoyl)hydrazinylidene]methyl]pyrazole-5-carboxamide (PubChem CID 90808593) has the molecular formula C20H16Cl2F3N9O2 and a molecular weight of 542.31 g/mol. Its IUPAC name is N-(2-carbamoyl-4-chloro-6-methylphenyl)-1-(3-chloro-2-pyridinyl)-3-[[(2,2,2-trifluoroethanehydrazonoyl)hydrazinylidene]methyl]pyrazole-5-carboxamide.
| Compound Name | N-(2-carbamoyl-4-chloro-6-methylphenyl)-1-(3-chloro-2-pyridinyl)-3-[[(2,2,2-trifluoroethanehydrazonoyl)hydrazinylidene]methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90808593 |
| Molecular Formula | C20H16Cl2F3N9O2 |
| Molecular Weight | 542.31 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | N-(2-carbamoyl-4-chloro-6-methylphenyl)-1-(3-chloro-2-pyridinyl)-3-[[(2,2,2-trifluoroethanehydrazonoyl)hydrazinylidene]methyl]pyrazole-5-carboxamide |
| SMILES | Cc1cc(Cl)cc(C(N)=O)c1NC(=O)c1cc(C=NN/C(=N/N)C(F)(F)F)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C20H16Cl2F3N9O2/c1-9-5-10(21)6-12(16(26)35)15(9)30-18(36)14-7-11(8-29-32-19(31-27)20(23,24)25)33-34(14)17-13(22)3-2-4-28-17/h2-8H,27H2,1H3,(H2,26,35)(H,30,36)(H,31,32) |
| InChIKey | GNDYCOGVHWJFFF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 165.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|