C20H18Cl2N6O4 — CID 50907759
5-N-[4-chloro-2-(methoxycarbamoyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-N-methylpyrazole-3,5-dicarboxamide (PubChem CID 50907759) has the molecular formula C20H18Cl2N6O4 and a molecular weight of 477.31 g/mol. Its IUPAC name is 5-N-[4-chloro-2-(methoxycarbamoyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-N-methylpyrazole-3,5-dicarboxamide.
| Compound Name | 5-N-[4-chloro-2-(methoxycarbamoyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-N-methylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 50907759 |
| Molecular Formula | C20H18Cl2N6O4 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 5-N-[4-chloro-2-(methoxycarbamoyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-N-methylpyrazole-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)Nc2c(C)cc(Cl)cc2C(=O)NOC)n(-c2ncccc2Cl)n1 |
| InChI | InChI=1S/C20H18Cl2N6O4/c1-10-7-11(21)8-12(18(29)27-32-3)16(10)25-20(31)15-9-14(19(30)23-2)26-28(15)17-13(22)5-4-6-24-17/h4-9H,1-3H3,(H,23,30)(H,25,31)(H,27,29) |
| InChIKey | CLPXEWFLPVFLJF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|