C18H15Cl2N5O3 — CID 141260277
3-chloro-1-(3-chloro-2-pyridinyl)-N-[2-(methoxycarbamoyl)-6-methylphenyl]pyrazole-5-carboxamide (PubChem CID 141260277) has the molecular formula C18H15Cl2N5O3 and a molecular weight of 420.26 g/mol. Its IUPAC name is 3-chloro-1-(3-chloro-2-pyridinyl)-N-[2-(methoxycarbamoyl)-6-methylphenyl]pyrazole-5-carboxamide.
| Compound Name | 3-chloro-1-(3-chloro-2-pyridinyl)-N-[2-(methoxycarbamoyl)-6-methylphenyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 141260277 |
| Molecular Formula | C18H15Cl2N5O3 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 3-chloro-1-(3-chloro-2-pyridinyl)-N-[2-(methoxycarbamoyl)-6-methylphenyl]pyrazole-5-carboxamide |
| SMILES | CONC(=O)c1cccc(C)c1NC(=O)c1cc(Cl)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C18H15Cl2N5O3/c1-10-5-3-6-11(17(26)24-28-2)15(10)22-18(27)13-9-14(20)23-25(13)16-12(19)7-4-8-21-16/h3-9H,1-2H3,(H,22,27)(H,24,26) |
| InChIKey | ICNHRGBHMXHXNL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|