C22H21Cl2N5O4 — CID 150740262
N-[4-chloro-2-(methoxycarbamoyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-(oxetan-3-ylmethyl)pyrazole-5-carboxamide (PubChem CID 150740262) has the molecular formula C22H21Cl2N5O4 and a molecular weight of 490.35 g/mol. Its IUPAC name is N-[4-chloro-2-(methoxycarbamoyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-(oxetan-3-ylmethyl)pyrazole-5-carboxamide.
| Compound Name | N-[4-chloro-2-(methoxycarbamoyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-(oxetan-3-ylmethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 150740262 |
| Molecular Formula | C22H21Cl2N5O4 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N-[4-chloro-2-(methoxycarbamoyl)-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-(oxetan-3-ylmethyl)pyrazole-5-carboxamide |
| SMILES | CONC(=O)c1cc(Cl)cc(C)c1NC(=O)c1cc(CC2COC2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C22H21Cl2N5O4/c1-12-6-14(23)8-16(21(30)28-32-2)19(12)26-22(31)18-9-15(7-13-10-33-11-13)27-29(18)20-17(24)4-3-5-25-20/h3-6,8-9,13H,7,10-11H2,1-2H3,(H,26,31)(H,28,30) |
| InChIKey | JTRUVJDDLUKAJL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|