C14H9Cl3N6O — CID 57381412
3-chloro-N',1-bis(3-chloro-2-pyridinyl)pyrazole-5-carbohydrazide (PubChem CID 57381412) has the molecular formula C14H9Cl3N6O and a molecular weight of 383.63 g/mol. Its IUPAC name is 3-chloro-N',1-bis(3-chloro-2-pyridinyl)pyrazole-5-carbohydrazide.
| Compound Name | 3-chloro-N',1-bis(3-chloro-2-pyridinyl)pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 57381412 |
| Molecular Formula | C14H9Cl3N6O |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 3-chloro-N',1-bis(3-chloro-2-pyridinyl)pyrazole-5-carbohydrazide |
| SMILES | O=C(NNc1ncccc1Cl)c1cc(Cl)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C14H9Cl3N6O/c15-8-3-1-5-18-12(8)20-21-14(24)10-7-11(17)22-23(10)13-9(16)4-2-6-19-13/h1-7H,(H,18,20)(H,21,24) |
| InChIKey | ZYTFBNYBPDXKCS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|