C10H4Cl2F3N3O — CID 18446928
1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carbonyl chloride (PubChem CID 18446928) has the molecular formula C10H4Cl2F3N3O and a molecular weight of 310.06 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carbonyl chloride.
| Compound Name | 1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 18446928 |
| Molecular Formula | C10H4Cl2F3N3O |
| Molecular Weight | 310.06 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(C(F)(F)F)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C10H4Cl2F3N3O/c11-5-2-1-3-16-9(5)18-6(8(12)19)4-7(17-18)10(13,14)15/h1-4H |
| InChIKey | HVIPOZXDKOWYGV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.06 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|