C17H11Cl2F3N6O2 — CID 174556945
N-[2-[amino(formyl)amino]-4-chlorophenyl]-1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 174556945) has the molecular formula C17H11Cl2F3N6O2 and a molecular weight of 459.22 g/mol. Its IUPAC name is N-[2-[amino(formyl)amino]-4-chlorophenyl]-1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-[2-[amino(formyl)amino]-4-chlorophenyl]-1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 174556945 |
| Molecular Formula | C17H11Cl2F3N6O2 |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | N-[2-[amino(formyl)amino]-4-chlorophenyl]-1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | NN(C=O)c1cc(Cl)ccc1NC(=O)c1cc(C(F)(F)F)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C17H11Cl2F3N6O2/c18-9-3-4-11(12(6-9)27(23)8-29)25-16(30)13-7-14(17(20,21)22)26-28(13)15-10(19)2-1-5-24-15/h1-8H,23H2,(H,25,30) |
| InChIKey | CANLHRGCUYVGKY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|