C21H21Cl3N4O2 — CID 147692954
3,5-dichloro-2-[[(E)-4-[(1S)-1-(3-chloro-2-pyridinyl)ethyl]imino-2-methylpent-2-enoyl]amino]-N-methylbenzamide (PubChem CID 147692954) has the molecular formula C21H21Cl3N4O2 and a molecular weight of 467.78 g/mol. Its IUPAC name is 3,5-dichloro-2-[[(E)-4-[(1S)-1-(3-chloro-2-pyridinyl)ethyl]imino-2-methylpent-2-enoyl]amino]-N-methylbenzamide.
| Compound Name | 3,5-dichloro-2-[[(E)-4-[(1S)-1-(3-chloro-2-pyridinyl)ethyl]imino-2-methylpent-2-enoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 147692954 |
| Molecular Formula | C21H21Cl3N4O2 |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 3,5-dichloro-2-[[(E)-4-[(1S)-1-(3-chloro-2-pyridinyl)ethyl]imino-2-methylpent-2-enoyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(Cl)cc(Cl)c1NC(=O)/C(C)=C/C(C)=N/[C@@H](C)c1ncccc1Cl |
| InChI | InChI=1S/C21H21Cl3N4O2/c1-11(8-12(2)27-13(3)18-16(23)6-5-7-26-18)20(29)28-19-15(21(30)25-4)9-14(22)10-17(19)24/h5-10,13H,1-4H3,(H,25,30)(H,28,29)/b11-8+,27-12+/t13-/m0/s1 |
| InChIKey | GRIBZURFTLJCCS-RUEXIDNFSA-N |
| XLogP | 5.51 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|