C17H13BCl3N5O2 — CID 88848968
CID 88848968 (PubChem CID 88848968) has the molecular formula C17H13BCl3N5O2 and a molecular weight of 436.50 g/mol.
| Compound Name | CID 88848968 |
|---|---|
| PubChem CID | 88848968 |
| Molecular Formula | C17H13BCl3N5O2 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | — |
| SMILES | [B]C1=NN(c2ncccc2Cl)C(C(=O)Nc2c(Cl)cc(Cl)cc2C(=O)NC)C1 |
| InChI | InChI=1S/C17H13BCl3N5O2/c1-22-16(27)9-5-8(19)6-11(21)14(9)24-17(28)12-7-13(18)25-26(12)15-10(20)3-2-4-23-15/h2-6,12H,7H2,1H3,(H,22,27)(H,24,28) |
| InChIKey | AMINYGJAUJIZHS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|