C17H12BCl3N4O2 — CID 89038333
CID 89038333 (PubChem CID 89038333) has the molecular formula C17H12BCl3N4O2 and a molecular weight of 421.48 g/mol.
| Compound Name | CID 89038333 |
|---|---|
| PubChem CID | 89038333 |
| Molecular Formula | C17H12BCl3N4O2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | — |
| SMILES | [B]C1=NN(c2ncccc2Cl)C(C(=O)Nc2c(Cl)cc(Cl)cc2C(C)=O)C1 |
| InChI | InChI=1S/C17H12BCl3N4O2/c1-8(26)10-5-9(19)6-12(21)15(10)23-17(27)13-7-14(18)24-25(13)16-11(20)3-2-4-22-16/h2-6,13H,7H2,1H3,(H,23,27) |
| InChIKey | CGQIANFDVKVMLM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|