C18H16B2ClN5O2 — CID 89038312
CID 89038312 (PubChem CID 89038312) has the molecular formula C18H16B2ClN5O2 and a molecular weight of 391.44 g/mol.
| Compound Name | CID 89038312 |
|---|---|
| PubChem CID | 89038312 |
| Molecular Formula | C18H16B2ClN5O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | — |
| SMILES | [B]C1=NN(c2ncccc2Cl)C(C(=O)Nc2c(C)cc([B])cc2C(=O)NC)C1 |
| InChI | InChI=1S/C18H16B2ClN5O2/c1-9-6-10(19)7-11(17(27)22-2)15(9)24-18(28)13-8-14(20)25-26(13)16-12(21)4-3-5-23-16/h3-7,13H,8H2,1-2H3,(H,22,27)(H,24,28) |
| InChIKey | LQTIABCDCOADAF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|