C12H14ClN3O5S — CID 166154467
ethyl 2-(3-chloro-2-pyridinyl)-5-methylsulfonyloxy-3,4-dihydropyrazole-3-carboxylate (PubChem CID 166154467) has the molecular formula C12H14ClN3O5S and a molecular weight of 347.78 g/mol. Its IUPAC name is ethyl 2-(3-chloro-2-pyridinyl)-5-methylsulfonyloxy-3,4-dihydropyrazole-3-carboxylate.
| Compound Name | ethyl 2-(3-chloro-2-pyridinyl)-5-methylsulfonyloxy-3,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 166154467 |
| Molecular Formula | C12H14ClN3O5S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | ethyl 2-(3-chloro-2-pyridinyl)-5-methylsulfonyloxy-3,4-dihydropyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1CC(OS(C)(=O)=O)=NN1c1ncccc1Cl |
| InChI | InChI=1S/C12H14ClN3O5S/c1-3-20-12(17)9-7-10(21-22(2,18)19)15-16(9)11-8(13)5-4-6-14-11/h4-6,9H,3,7H2,1-2H3 |
| InChIKey | OVRLVAYMAXMJOS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|