C12H15N3O4 — CID 62004802
ethyl 1-(3-nitro-2-pyridinyl)pyrrolidine-2-carboxylate (PubChem CID 62004802) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is ethyl 1-(3-nitro-2-pyridinyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(3-nitro-2-pyridinyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62004802 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | ethyl 1-(3-nitro-2-pyridinyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1c1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O4/c1-2-19-12(16)10-6-4-8-14(10)11-9(15(17)18)5-3-7-13-11/h3,5,7,10H,2,4,6,8H2,1H3 |
| InChIKey | LSAJAPNTAHSICE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|