C11H13N3O4 — CID 61371100
2-[1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]acetic acid (PubChem CID 61371100) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 61371100 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[1-(3-nitro-2-pyridinyl)pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN1c1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O4/c15-10(16)7-8-3-2-6-13(8)11-9(14(17)18)4-1-5-12-11/h1,4-5,8H,2-3,6-7H2,(H,15,16) |
| InChIKey | PICJTGHFDYFYMN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|