C13H16N4O2 — CID 104729407
2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid (PubChem CID 104729407) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid.
| Compound Name | 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid |
|---|---|
| PubChem CID | 104729407 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid |
| SMILES | O=C(O)CC1CCCCN1c1nccn2nccc12 |
| InChI | InChI=1S/C13H16N4O2/c18-12(19)9-10-3-1-2-7-16(10)13-11-4-5-15-17(11)8-6-14-13/h4-6,8,10H,1-3,7,9H2,(H,18,19) |
| InChIKey | ZMDMHDFXDXRSQS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |