2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid

C13H16N4O2 — CID 104729407

IUPAC2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid
SMILESO=C(O)CC1CCCCN1c1nccn2nccc12
InChIInChI=1S/C13H16N4O2/c18-12(19)9-10-3-1-2-7-16(10)13-11-4-5-15-17(11)8-6-14-13/h4-6,8,10H,1-3,7,9H2,(H,18,19)
InChIKeyZMDMHDFXDXRSQS-UHFFFAOYSA-N
MW260.30 g/mol
LogP1.56
Rot. Bonds3

About 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid

2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid (PubChem CID 104729407) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid.

Molecular Properties

Compound Name2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid
PubChem CID104729407
Molecular FormulaC13H16N4O2
Molecular Weight260.30 g/mol
Exact Mass260.13
IUPAC Name2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid
SMILESO=C(O)CC1CCCCN1c1nccn2nccc12
InChIInChI=1S/C13H16N4O2/c18-12(19)9-10-3-1-2-7-16(10)13-11-4-5-15-17(11)8-6-14-13/h4-6,8,10H,1-3,7,9H2,(H,18,19)
InChIKeyZMDMHDFXDXRSQS-UHFFFAOYSA-N
XLogP1.56
TPSA70.73 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.30
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid?
The IUPAC name of 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid (CID 104729407) is 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid.
What is the SMILES notation for 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid?
The canonical SMILES for 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid is O=C(O)CC1CCCCN1c1nccn2nccc12.
What is the InChIKey of 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid?
The InChIKey is ZMDMHDFXDXRSQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c18-12(19)9-10-3-1-2-7-16(10)13-11-4-5-15-17(11)8-6-14-13/h4-6,8,10H,1-3,7,9H2,(H,18,19).
What are the key properties of 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid?
2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid has a molecular weight of 260.30 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-2-yl)acetic acid is sourced from PubChem (CID 104729407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).